C16H26ClNO3S — CID 21078493
3-chloro-N-[(3S,4S)-5-hydroxy-3-methylnonan-4-yl]benzenesulfonamide (PubChem CID 21078493) has the molecular formula C16H26ClNO3S and a molecular weight of 347.91 g/mol. Its IUPAC name is 3-chloro-N-[(3S,4S)-5-hydroxy-3-methylnonan-4-yl]benzenesulfonamide.
| Compound Name | 3-chloro-N-[(3S,4S)-5-hydroxy-3-methylnonan-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 21078493 |
| Molecular Formula | C16H26ClNO3S |
| Molecular Weight | 347.91 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 3-chloro-N-[(3S,4S)-5-hydroxy-3-methylnonan-4-yl]benzenesulfonamide |
| SMILES | CCCCC(O)[C@@H](NS(=O)(=O)c1cccc(Cl)c1)[C@@H](C)CC |
| InChI | InChI=1S/C16H26ClNO3S/c1-4-6-10-15(19)16(12(3)5-2)18-22(20,21)14-9-7-8-13(17)11-14/h7-9,11-12,15-16,18-19H,4-6,10H2,1-3H3/t12-,15?,16-/m0/s1 |
| InChIKey | MBBDUWGSXMCAKB-IRNAAHPTSA-N |
| XLogP | 3.58 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.91 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |