C21H24Cl2N2O5S — CID 20610235
2-[[2-[(3,5-dichlorophenyl)sulfonylamino]-3-phenylpropanoyl]amino]hexanoic acid (PubChem CID 20610235) has the molecular formula C21H24Cl2N2O5S and a molecular weight of 487.41 g/mol. Its IUPAC name is 2-[[2-[(3,5-dichlorophenyl)sulfonylamino]-3-phenylpropanoyl]amino]hexanoic acid.
| Compound Name | 2-[[2-[(3,5-dichlorophenyl)sulfonylamino]-3-phenylpropanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 20610235 |
| Molecular Formula | C21H24Cl2N2O5S |
| Molecular Weight | 487.41 g/mol |
| Exact Mass | 486.08 |
| IUPAC Name | 2-[[2-[(3,5-dichlorophenyl)sulfonylamino]-3-phenylpropanoyl]amino]hexanoic acid |
| SMILES | CCCCC(NC(=O)C(Cc1ccccc1)NS(=O)(=O)c1cc(Cl)cc(Cl)c1)C(=O)O |
| InChI | InChI=1S/C21H24Cl2N2O5S/c1-2-3-9-18(21(27)28)24-20(26)19(10-14-7-5-4-6-8-14)25-31(29,30)17-12-15(22)11-16(23)13-17/h4-8,11-13,18-19,25H,2-3,9-10H2,1H3,(H,24,26)(H,27,28) |
| InChIKey | WVADVCMDSJNDKV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |