C13H20ClNO3S — CID 103836329
3-chloro-N-[2-(2-hydroxyethyl)pentyl]benzenesulfonamide (PubChem CID 103836329) has the molecular formula C13H20ClNO3S and a molecular weight of 305.83 g/mol. Its IUPAC name is 3-chloro-N-[2-(2-hydroxyethyl)pentyl]benzenesulfonamide.
| Compound Name | 3-chloro-N-[2-(2-hydroxyethyl)pentyl]benzenesulfonamide |
|---|---|
| PubChem CID | 103836329 |
| Molecular Formula | C13H20ClNO3S |
| Molecular Weight | 305.83 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 3-chloro-N-[2-(2-hydroxyethyl)pentyl]benzenesulfonamide |
| SMILES | CCCC(CCO)CNS(=O)(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H20ClNO3S/c1-2-4-11(7-8-16)10-15-19(17,18)13-6-3-5-12(14)9-13/h3,5-6,9,11,15-16H,2,4,7-8,10H2,1H3 |
| InChIKey | YQJQMUQCKMUUGB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.83 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |