C11H18ClNO3S2 — CID 103836355
5-chloro-N-[2-(2-hydroxyethyl)pentyl]thiophene-2-sulfonamide (PubChem CID 103836355) has the molecular formula C11H18ClNO3S2 and a molecular weight of 311.86 g/mol. Its IUPAC name is 5-chloro-N-[2-(2-hydroxyethyl)pentyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[2-(2-hydroxyethyl)pentyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 103836355 |
| Molecular Formula | C11H18ClNO3S2 |
| Molecular Weight | 311.86 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | 5-chloro-N-[2-(2-hydroxyethyl)pentyl]thiophene-2-sulfonamide |
| SMILES | CCCC(CCO)CNS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C11H18ClNO3S2/c1-2-3-9(6-7-14)8-13-18(15,16)11-5-4-10(12)17-11/h4-5,9,13-14H,2-3,6-8H2,1H3 |
| InChIKey | WOVGPUVIZPEFEP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.86 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |