C7H9ClN2O4S2 — CID 107258327
3-[(5-chlorothiophen-2-yl)sulfonylamino]-2-hydroxypropanamide (PubChem CID 107258327) has the molecular formula C7H9ClN2O4S2 and a molecular weight of 284.75 g/mol. Its IUPAC name is 3-[(5-chlorothiophen-2-yl)sulfonylamino]-2-hydroxypropanamide.
| Compound Name | 3-[(5-chlorothiophen-2-yl)sulfonylamino]-2-hydroxypropanamide |
|---|---|
| PubChem CID | 107258327 |
| Molecular Formula | C7H9ClN2O4S2 |
| Molecular Weight | 284.75 g/mol |
| Exact Mass | 283.97 |
| IUPAC Name | 3-[(5-chlorothiophen-2-yl)sulfonylamino]-2-hydroxypropanamide |
| SMILES | NC(=O)C(O)CNS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C7H9ClN2O4S2/c8-5-1-2-6(15-5)16(13,14)10-3-4(11)7(9)12/h1-2,4,10-11H,3H2,(H2,9,12) |
| InChIKey | WJXCVBGJRUKRCL-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.75 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |