C10H16ClN3O3S2 — CID 119498376
N-(3-aminobutyl)-2-[(5-chlorothiophen-2-yl)sulfonylamino]acetamide (PubChem CID 119498376) has the molecular formula C10H16ClN3O3S2 and a molecular weight of 325.84 g/mol. Its IUPAC name is N-(3-aminobutyl)-2-[(5-chlorothiophen-2-yl)sulfonylamino]acetamide.
| Compound Name | N-(3-aminobutyl)-2-[(5-chlorothiophen-2-yl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 119498376 |
| Molecular Formula | C10H16ClN3O3S2 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | N-(3-aminobutyl)-2-[(5-chlorothiophen-2-yl)sulfonylamino]acetamide |
| SMILES | CC(N)CCNC(=O)CNS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C10H16ClN3O3S2/c1-7(12)4-5-13-9(15)6-14-19(16,17)10-3-2-8(11)18-10/h2-3,7,14H,4-6,12H2,1H3,(H,13,15) |
| InChIKey | ZSYRJEPPYMABRZ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |