C8H10ClNO3S2 — CID 47108883
N-(5-chlorothiophen-2-yl)sulfonyl-2-methylpropanamide (PubChem CID 47108883) has the molecular formula C8H10ClNO3S2 and a molecular weight of 267.76 g/mol. Its IUPAC name is N-(5-chlorothiophen-2-yl)sulfonyl-2-methylpropanamide.
| Compound Name | N-(5-chlorothiophen-2-yl)sulfonyl-2-methylpropanamide |
|---|---|
| PubChem CID | 47108883 |
| Molecular Formula | C8H10ClNO3S2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 266.98 |
| IUPAC Name | N-(5-chlorothiophen-2-yl)sulfonyl-2-methylpropanamide |
| SMILES | CC(C)C(=O)NS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C8H10ClNO3S2/c1-5(2)8(11)10-15(12,13)7-4-3-6(9)14-7/h3-5H,1-2H3,(H,10,11) |
| InChIKey | MWMBOEIIBSPXPU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |