C8H11ClN2O3S2 — CID 134117146
1-(5-chlorothiophen-2-yl)sulfonyl-3-propylurea (PubChem CID 134117146) has the molecular formula C8H11ClN2O3S2 and a molecular weight of 282.77 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)sulfonyl-3-propylurea.
| Compound Name | 1-(5-chlorothiophen-2-yl)sulfonyl-3-propylurea |
|---|---|
| PubChem CID | 134117146 |
| Molecular Formula | C8H11ClN2O3S2 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 281.99 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)sulfonyl-3-propylurea |
| SMILES | CCCNC(=O)NS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C8H11ClN2O3S2/c1-2-5-10-8(12)11-16(13,14)7-4-3-6(9)15-7/h3-4H,2,5H2,1H3,(H2,10,11,12) |
| InChIKey | MMZRARACZNYPFX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |