C14H25ClN2O2S2 — CID 4996654
5-chloro-N-[2-(dibutylamino)ethyl]thiophene-2-sulfonamide (PubChem CID 4996654) has the molecular formula C14H25ClN2O2S2 and a molecular weight of 352.95 g/mol. Its IUPAC name is 5-chloro-N-[2-(dibutylamino)ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[2-(dibutylamino)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 4996654 |
| Molecular Formula | C14H25ClN2O2S2 |
| Molecular Weight | 352.95 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 5-chloro-N-[2-(dibutylamino)ethyl]thiophene-2-sulfonamide |
| SMILES | CCCCN(CCCC)CCNS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C14H25ClN2O2S2/c1-3-5-10-17(11-6-4-2)12-9-16-21(18,19)14-8-7-13(15)20-14/h7-8,16H,3-6,9-12H2,1-2H3 |
| InChIKey | BHEUYZFRXIFPAV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.95 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |