C13H15ClN2O4S3 — CID 133451579
5-chloro-N-[2-(4-methylsulfonylanilino)ethyl]thiophene-2-sulfonamide (PubChem CID 133451579) has the molecular formula C13H15ClN2O4S3 and a molecular weight of 394.93 g/mol. Its IUPAC name is 5-chloro-N-[2-(4-methylsulfonylanilino)ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[2-(4-methylsulfonylanilino)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 133451579 |
| Molecular Formula | C13H15ClN2O4S3 |
| Molecular Weight | 394.93 g/mol |
| Exact Mass | 393.99 |
| IUPAC Name | 5-chloro-N-[2-(4-methylsulfonylanilino)ethyl]thiophene-2-sulfonamide |
| SMILES | CS(=O)(=O)c1ccc(NCCNS(=O)(=O)c2ccc(Cl)s2)cc1 |
| InChI | InChI=1S/C13H15ClN2O4S3/c1-22(17,18)11-4-2-10(3-5-11)15-8-9-16-23(19,20)13-7-6-12(14)21-13/h2-7,15-16H,8-9H2,1H3 |
| InChIKey | IYXBQUQNTXLYJL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.93 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|