C11H7ClF3NO4S3 — CID 166200870
5-chloro-N-[4-(trifluoromethylsulfonyl)phenyl]thiophene-2-sulfonamide (PubChem CID 166200870) has the molecular formula C11H7ClF3NO4S3 and a molecular weight of 405.83 g/mol. Its IUPAC name is 5-chloro-N-[4-(trifluoromethylsulfonyl)phenyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[4-(trifluoromethylsulfonyl)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 166200870 |
| Molecular Formula | C11H7ClF3NO4S3 |
| Molecular Weight | 405.83 g/mol |
| Exact Mass | 404.92 |
| IUPAC Name | 5-chloro-N-[4-(trifluoromethylsulfonyl)phenyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(S(=O)(=O)C(F)(F)F)cc1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C11H7ClF3NO4S3/c12-9-5-6-10(21-9)23(19,20)16-7-1-3-8(4-2-7)22(17,18)11(13,14)15/h1-6,16H |
| InChIKey | OXOPRXXKJVIMMU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.83 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |