C12H9ClF3NO2S2 — CID 24580783
5-chloro-N-[4-methyl-3-(trifluoromethyl)phenyl]thiophene-2-sulfonamide (PubChem CID 24580783) has the molecular formula C12H9ClF3NO2S2 and a molecular weight of 355.79 g/mol. Its IUPAC name is 5-chloro-N-[4-methyl-3-(trifluoromethyl)phenyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[4-methyl-3-(trifluoromethyl)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 24580783 |
| Molecular Formula | C12H9ClF3NO2S2 |
| Molecular Weight | 355.79 g/mol |
| Exact Mass | 354.97 |
| IUPAC Name | 5-chloro-N-[4-methyl-3-(trifluoromethyl)phenyl]thiophene-2-sulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(Cl)s2)cc1C(F)(F)F |
| InChI | InChI=1S/C12H9ClF3NO2S2/c1-7-2-3-8(6-9(7)12(14,15)16)17-21(18,19)11-5-4-10(13)20-11/h2-6,17H,1H3 |
| InChIKey | JGCDERCIEZEWGG-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.79 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |