C14H12F3NO4S2 — CID 51121366
3-methyl-5-[[4-methyl-3-(trifluoromethyl)phenyl]sulfamoyl]thiophene-2-carboxylic acid (PubChem CID 51121366) has the molecular formula C14H12F3NO4S2 and a molecular weight of 379.38 g/mol. Its IUPAC name is 3-methyl-5-[[4-methyl-3-(trifluoromethyl)phenyl]sulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 3-methyl-5-[[4-methyl-3-(trifluoromethyl)phenyl]sulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 51121366 |
| Molecular Formula | C14H12F3NO4S2 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | 3-methyl-5-[[4-methyl-3-(trifluoromethyl)phenyl]sulfamoyl]thiophene-2-carboxylic acid |
| SMILES | Cc1ccc(NS(=O)(=O)c2cc(C)c(C(=O)O)s2)cc1C(F)(F)F |
| InChI | InChI=1S/C14H12F3NO4S2/c1-7-3-4-9(6-10(7)14(15,16)17)18-24(21,22)11-5-8(2)12(23-11)13(19)20/h3-6,18H,1-2H3,(H,19,20) |
| InChIKey | UKQTVMBVNFMITN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |