C13H13NO4S3 — CID 43311197
3-methyl-5-[(4-methylsulfanylphenyl)sulfamoyl]thiophene-2-carboxylic acid (PubChem CID 43311197) has the molecular formula C13H13NO4S3 and a molecular weight of 343.45 g/mol. Its IUPAC name is 3-methyl-5-[(4-methylsulfanylphenyl)sulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 3-methyl-5-[(4-methylsulfanylphenyl)sulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 43311197 |
| Molecular Formula | C13H13NO4S3 |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | 3-methyl-5-[(4-methylsulfanylphenyl)sulfamoyl]thiophene-2-carboxylic acid |
| SMILES | CSc1ccc(NS(=O)(=O)c2cc(C)c(C(=O)O)s2)cc1 |
| InChI | InChI=1S/C13H13NO4S3/c1-8-7-11(20-12(8)13(15)16)21(17,18)14-9-3-5-10(19-2)6-4-9/h3-7,14H,1-2H3,(H,15,16) |
| InChIKey | JVURCEGCUGDTSI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |