C12H8F3NO4S2 — CID 51115485
3-methyl-5-[(2,3,4-trifluorophenyl)sulfamoyl]thiophene-2-carboxylic acid (PubChem CID 51115485) has the molecular formula C12H8F3NO4S2 and a molecular weight of 351.33 g/mol. Its IUPAC name is 3-methyl-5-[(2,3,4-trifluorophenyl)sulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 3-methyl-5-[(2,3,4-trifluorophenyl)sulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 51115485 |
| Molecular Formula | C12H8F3NO4S2 |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 350.98 |
| IUPAC Name | 3-methyl-5-[(2,3,4-trifluorophenyl)sulfamoyl]thiophene-2-carboxylic acid |
| SMILES | Cc1cc(S(=O)(=O)Nc2ccc(F)c(F)c2F)sc1C(=O)O |
| InChI | InChI=1S/C12H8F3NO4S2/c1-5-4-8(21-11(5)12(17)18)22(19,20)16-7-3-2-6(13)9(14)10(7)15/h2-4,16H,1H3,(H,17,18) |
| InChIKey | SWNINSZBXLIXQI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|