C12H11BrN2O5S2 — CID 71847214
5-[(2-bromo-6-methoxy-3-pyridinyl)sulfamoyl]-3-methylthiophene-2-carboxylic acid (PubChem CID 71847214) has the molecular formula C12H11BrN2O5S2 and a molecular weight of 407.27 g/mol. Its IUPAC name is 5-[(2-bromo-6-methoxy-3-pyridinyl)sulfamoyl]-3-methylthiophene-2-carboxylic acid.
| Compound Name | 5-[(2-bromo-6-methoxy-3-pyridinyl)sulfamoyl]-3-methylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 71847214 |
| Molecular Formula | C12H11BrN2O5S2 |
| Molecular Weight | 407.27 g/mol |
| Exact Mass | 405.93 |
| IUPAC Name | 5-[(2-bromo-6-methoxy-3-pyridinyl)sulfamoyl]-3-methylthiophene-2-carboxylic acid |
| SMILES | COc1ccc(NS(=O)(=O)c2cc(C)c(C(=O)O)s2)c(Br)n1 |
| InChI | InChI=1S/C12H11BrN2O5S2/c1-6-5-9(21-10(6)12(16)17)22(18,19)15-7-3-4-8(20-2)14-11(7)13/h3-5,15H,1-2H3,(H,16,17) |
| InChIKey | QCMXPSVBULUXNL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|