C11H6F3NO4S2 — CID 61026611
5-[(2,3,4-trifluorophenyl)sulfamoyl]thiophene-2-carboxylic acid (PubChem CID 61026611) has the molecular formula C11H6F3NO4S2 and a molecular weight of 337.30 g/mol. Its IUPAC name is 5-[(2,3,4-trifluorophenyl)sulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[(2,3,4-trifluorophenyl)sulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 61026611 |
| Molecular Formula | C11H6F3NO4S2 |
| Molecular Weight | 337.30 g/mol |
| Exact Mass | 336.97 |
| IUPAC Name | 5-[(2,3,4-trifluorophenyl)sulfamoyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)Nc2ccc(F)c(F)c2F)s1 |
| InChI | InChI=1S/C11H6F3NO4S2/c12-5-1-2-6(10(14)9(5)13)15-21(18,19)8-4-3-7(20-8)11(16)17/h1-4,15H,(H,16,17) |
| InChIKey | PNQSIAAFRMRBKA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|