C11H7N3O4S2Se — CID 61027657
5-(2,1,3-benzoselenadiazol-4-ylsulfamoyl)thiophene-2-carboxylic acid (PubChem CID 61027657) has the molecular formula C11H7N3O4S2Se and a molecular weight of 388.29 g/mol. Its IUPAC name is 5-(2,1,3-benzoselenadiazol-4-ylsulfamoyl)thiophene-2-carboxylic acid.
| Compound Name | 5-(2,1,3-benzoselenadiazol-4-ylsulfamoyl)thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 61027657 |
| Molecular Formula | C11H7N3O4S2Se |
| Molecular Weight | 388.29 g/mol |
| Exact Mass | 388.90 |
| IUPAC Name | 5-(2,1,3-benzoselenadiazol-4-ylsulfamoyl)thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)Nc2cccc3n[se]nc23)s1 |
| InChI | InChI=1S/C11H7N3O4S2Se/c15-11(16)8-4-5-9(19-8)20(17,18)12-6-2-1-3-7-10(6)14-21-13-7/h1-5,12H,(H,15,16) |
| InChIKey | TWXGHSGYCKSYJH-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.29 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|