C7H6ClN3O2SSe — CID 63665160
N-(2,1,3-benzoselenadiazol-4-yl)-1-chloromethanesulfonamide (PubChem CID 63665160) has the molecular formula C7H6ClN3O2SSe and a molecular weight of 310.62 g/mol. Its IUPAC name is N-(2,1,3-benzoselenadiazol-4-yl)-1-chloromethanesulfonamide.
| Compound Name | N-(2,1,3-benzoselenadiazol-4-yl)-1-chloromethanesulfonamide |
|---|---|
| PubChem CID | 63665160 |
| Molecular Formula | C7H6ClN3O2SSe |
| Molecular Weight | 310.62 g/mol |
| Exact Mass | 310.90 |
| IUPAC Name | N-(2,1,3-benzoselenadiazol-4-yl)-1-chloromethanesulfonamide |
| SMILES | O=S(=O)(CCl)Nc1cccc2n[se]nc12 |
| InChI | InChI=1S/C7H6ClN3O2SSe/c8-4-14(12,13)9-5-2-1-3-6-7(5)11-15-10-6/h1-3,9H,4H2 |
| InChIKey | OIUHCQWJGSRHNL-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.62 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|