About 5-(1,3-thiazol-2-ylmethylsulfamoyl)thiophene-2-carboxylic acid
5-(1,3-thiazol-2-ylmethylsulfamoyl)thiophene-2-carboxylic acid (PubChem CID 61283860) has the molecular formula C9H8N2O4S3
and a molecular weight of 304.37 g/mol. Its IUPAC name is 5-(1,3-thiazol-2-ylmethylsulfamoyl)thiophene-2-carboxylic acid.
Analyze 5-(1,3-thiazol-2-ylmethylsulfamoyl)thiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,3-thiazol-2-ylmethylsulfamoyl)thiophene-2-carboxylic acid?
The IUPAC name of 5-(1,3-thiazol-2-ylmethylsulfamoyl)thiophene-2-carboxylic acid (CID 61283860) is 5-(1,3-thiazol-2-ylmethylsulfamoyl)thiophene-2-carboxylic acid.
What is the SMILES notation for 5-(1,3-thiazol-2-ylmethylsulfamoyl)thiophene-2-carboxylic acid?
The canonical SMILES for 5-(1,3-thiazol-2-ylmethylsulfamoyl)thiophene-2-carboxylic acid is O=C(O)c1ccc(S(=O)(=O)NCc2nccs2)s1.
What is the InChIKey of 5-(1,3-thiazol-2-ylmethylsulfamoyl)thiophene-2-carboxylic acid?
The InChIKey is DRQVLDNSJMFLCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O4S3/c12-9(13)6-1-2-8(17-6)18(14,15)11-5-7-10-3-4-16-7/h1-4,11H,5H2,(H,12,13).
What are the key properties of 5-(1,3-thiazol-2-ylmethylsulfamoyl)thiophene-2-carboxylic acid?
5-(1,3-thiazol-2-ylmethylsulfamoyl)thiophene-2-carboxylic acid has a molecular weight of 304.37 g/mol, XLogP of 1.38, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-thiazol-2-ylmethylsulfamoyl)thiophene-2-carboxylic acid is sourced from PubChem (CID 61283860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).