5-(1,3-thiazol-2-ylmethylcarbamoyl)thiophene-2-carboxylic acid

C10H8N2O3S2 — CID 55021448

IUPAC5-(1,3-thiazol-2-ylmethylcarbamoyl)thiophene-2-carboxylic acid
SMILESO=C(O)c1ccc(C(=O)NCc2nccs2)s1
InChIInChI=1S/C10H8N2O3S2/c13-9(12-5-8-11-3-4-16-8)6-1-2-7(17-6)10(14)15/h1-4H,5H2,(H,12,13)(H,14,15)
InChIKeyAPNRDJMJSCQMSO-UHFFFAOYSA-N
MW268.32 g/mol
LogP1.83
Rot. Bonds4

About 5-(1,3-thiazol-2-ylmethylcarbamoyl)thiophene-2-carboxylic acid

5-(1,3-thiazol-2-ylmethylcarbamoyl)thiophene-2-carboxylic acid (PubChem CID 55021448) has the molecular formula C10H8N2O3S2 and a molecular weight of 268.32 g/mol. Its IUPAC name is 5-(1,3-thiazol-2-ylmethylcarbamoyl)thiophene-2-carboxylic acid.

Molecular Properties

Compound Name5-(1,3-thiazol-2-ylmethylcarbamoyl)thiophene-2-carboxylic acid
PubChem CID55021448
Molecular FormulaC10H8N2O3S2
Molecular Weight268.32 g/mol
Exact Mass268.00
IUPAC Name5-(1,3-thiazol-2-ylmethylcarbamoyl)thiophene-2-carboxylic acid
SMILESO=C(O)c1ccc(C(=O)NCc2nccs2)s1
InChIInChI=1S/C10H8N2O3S2/c13-9(12-5-8-11-3-4-16-8)6-1-2-7(17-6)10(14)15/h1-4H,5H2,(H,12,13)(H,14,15)
InChIKeyAPNRDJMJSCQMSO-UHFFFAOYSA-N
XLogP1.83
TPSA79.29 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.32
LogP ≤ 51.83
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 5-(1,3-thiazol-2-ylmethylcarbamoyl)thiophene-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(1,3-thiazol-2-ylmethylcarbamoyl)thiophene-2-carboxylic acid?
The IUPAC name of 5-(1,3-thiazol-2-ylmethylcarbamoyl)thiophene-2-carboxylic acid (CID 55021448) is 5-(1,3-thiazol-2-ylmethylcarbamoyl)thiophene-2-carboxylic acid.
What is the SMILES notation for 5-(1,3-thiazol-2-ylmethylcarbamoyl)thiophene-2-carboxylic acid?
The canonical SMILES for 5-(1,3-thiazol-2-ylmethylcarbamoyl)thiophene-2-carboxylic acid is O=C(O)c1ccc(C(=O)NCc2nccs2)s1.
What is the InChIKey of 5-(1,3-thiazol-2-ylmethylcarbamoyl)thiophene-2-carboxylic acid?
The InChIKey is APNRDJMJSCQMSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O3S2/c13-9(12-5-8-11-3-4-16-8)6-1-2-7(17-6)10(14)15/h1-4H,5H2,(H,12,13)(H,14,15).
What are the key properties of 5-(1,3-thiazol-2-ylmethylcarbamoyl)thiophene-2-carboxylic acid?
5-(1,3-thiazol-2-ylmethylcarbamoyl)thiophene-2-carboxylic acid has a molecular weight of 268.32 g/mol, XLogP of 1.83, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-thiazol-2-ylmethylcarbamoyl)thiophene-2-carboxylic acid is sourced from PubChem (CID 55021448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).