C12H10N2O3S2 — CID 109375248
(E)-3-[5-(1,3-thiazol-2-ylmethylcarbamoyl)thiophen-2-yl]prop-2-enoic acid (PubChem CID 109375248) has the molecular formula C12H10N2O3S2 and a molecular weight of 294.36 g/mol. Its IUPAC name is (E)-3-[5-(1,3-thiazol-2-ylmethylcarbamoyl)thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-(1,3-thiazol-2-ylmethylcarbamoyl)thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 109375248 |
| Molecular Formula | C12H10N2O3S2 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | (E)-3-[5-(1,3-thiazol-2-ylmethylcarbamoyl)thiophen-2-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(C(=O)NCc2nccs2)s1 |
| InChI | InChI=1S/C12H10N2O3S2/c15-11(16)4-2-8-1-3-9(19-8)12(17)14-7-10-13-5-6-18-10/h1-6H,7H2,(H,14,17)(H,15,16)/b4-2+ |
| InChIKey | XJGGUSDFEIIXHZ-DUXPYHPUSA-N |
| XLogP | 2.23 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|