C15H14N2O3S — CID 114957413
(E)-3-[5-[(4-methyl-3-pyridinyl)methylcarbamoyl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 114957413) has the molecular formula C15H14N2O3S and a molecular weight of 302.36 g/mol. Its IUPAC name is (E)-3-[5-[(4-methyl-3-pyridinyl)methylcarbamoyl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-[(4-methyl-3-pyridinyl)methylcarbamoyl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 114957413 |
| Molecular Formula | C15H14N2O3S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | (E)-3-[5-[(4-methyl-3-pyridinyl)methylcarbamoyl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | Cc1ccncc1CNC(=O)c1ccc(/C=C/C(=O)O)s1 |
| InChI | InChI=1S/C15H14N2O3S/c1-10-6-7-16-8-11(10)9-17-15(20)13-4-2-12(21-13)3-5-14(18)19/h2-8H,9H2,1H3,(H,17,20)(H,18,19)/b5-3+ |
| InChIKey | RLKYUMGNKCDVOA-HWKANZROSA-N |
| XLogP | 2.48 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|