C13H13N3O3S — CID 76989072
3-[5-[(2-methylpyrazol-3-yl)methylcarbamoyl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 76989072) has the molecular formula C13H13N3O3S and a molecular weight of 291.33 g/mol. Its IUPAC name is 3-[5-[(2-methylpyrazol-3-yl)methylcarbamoyl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | 3-[5-[(2-methylpyrazol-3-yl)methylcarbamoyl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76989072 |
| Molecular Formula | C13H13N3O3S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 3-[5-[(2-methylpyrazol-3-yl)methylcarbamoyl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | Cn1nccc1CNC(=O)c1ccc(C=CC(=O)O)s1 |
| InChI | InChI=1S/C13H13N3O3S/c1-16-9(6-7-15-16)8-14-13(19)11-4-2-10(20-11)3-5-12(17)18/h2-7H,8H2,1H3,(H,14,19)(H,17,18) |
| InChIKey | QTGIETZVLCEEPB-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|