C8H11N3O2 — CID 103252130
(E)-3-[(2-methylpyrazol-3-yl)methylamino]prop-2-enoic acid (PubChem CID 103252130) has the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. Its IUPAC name is (E)-3-[(2-methylpyrazol-3-yl)methylamino]prop-2-enoic acid.
| Compound Name | (E)-3-[(2-methylpyrazol-3-yl)methylamino]prop-2-enoic acid |
|---|---|
| PubChem CID | 103252130 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | (E)-3-[(2-methylpyrazol-3-yl)methylamino]prop-2-enoic acid |
| SMILES | Cn1nccc1CN/C=C/C(=O)O |
| InChI | InChI=1S/C8H11N3O2/c1-11-7(2-5-10-11)6-9-4-3-8(12)13/h2-5,9H,6H2,1H3,(H,12,13)/b4-3+ |
| InChIKey | QFWOLGHHYLEFQH-ONEGZZNKSA-N |
| XLogP | 0.11 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|