C9H7N3O2S3 — CID 114166198
5-cyano-N-(1,3-thiazol-2-ylmethyl)thiophene-2-sulfonamide (PubChem CID 114166198) has the molecular formula C9H7N3O2S3 and a molecular weight of 285.38 g/mol. Its IUPAC name is 5-cyano-N-(1,3-thiazol-2-ylmethyl)thiophene-2-sulfonamide.
| Compound Name | 5-cyano-N-(1,3-thiazol-2-ylmethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 114166198 |
| Molecular Formula | C9H7N3O2S3 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 284.97 |
| IUPAC Name | 5-cyano-N-(1,3-thiazol-2-ylmethyl)thiophene-2-sulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)NCc2nccs2)s1 |
| InChI | InChI=1S/C9H7N3O2S3/c10-5-7-1-2-9(16-7)17(13,14)12-6-8-11-3-4-15-8/h1-4,12H,6H2 |
| InChIKey | AXBNDXPHIMAVFV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 82.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |