C9H10N2O2S3 — CID 110738878
5-methyl-N-(1,3-thiazol-2-ylmethyl)thiophene-2-sulfonamide (PubChem CID 110738878) has the molecular formula C9H10N2O2S3 and a molecular weight of 274.39 g/mol. Its IUPAC name is 5-methyl-N-(1,3-thiazol-2-ylmethyl)thiophene-2-sulfonamide.
| Compound Name | 5-methyl-N-(1,3-thiazol-2-ylmethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110738878 |
| Molecular Formula | C9H10N2O2S3 |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | 5-methyl-N-(1,3-thiazol-2-ylmethyl)thiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCc2nccs2)s1 |
| InChI | InChI=1S/C9H10N2O2S3/c1-7-2-3-9(15-7)16(12,13)11-6-8-10-4-5-14-8/h2-5,11H,6H2,1H3 |
| InChIKey | AQWWULJDGLSQPL-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |