C10H9ClN2O2S2 — CID 110440454
4-chloro-N-(1,3-thiazol-2-ylmethyl)benzenesulfonamide (PubChem CID 110440454) has the molecular formula C10H9ClN2O2S2 and a molecular weight of 288.78 g/mol. Its IUPAC name is 4-chloro-N-(1,3-thiazol-2-ylmethyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-(1,3-thiazol-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 110440454 |
| Molecular Formula | C10H9ClN2O2S2 |
| Molecular Weight | 288.78 g/mol |
| Exact Mass | 287.98 |
| IUPAC Name | 4-chloro-N-(1,3-thiazol-2-ylmethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCc1nccs1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H9ClN2O2S2/c11-8-1-3-9(4-2-8)17(14,15)13-7-10-12-5-6-16-10/h1-6,13H,7H2 |
| InChIKey | BAUBKZDIYPNIPM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.78 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |