C14H12N2O2S2 — CID 110443097
N-(1,3-thiazol-2-ylmethyl)naphthalene-2-sulfonamide (PubChem CID 110443097) has the molecular formula C14H12N2O2S2 and a molecular weight of 304.40 g/mol. Its IUPAC name is N-(1,3-thiazol-2-ylmethyl)naphthalene-2-sulfonamide.
| Compound Name | N-(1,3-thiazol-2-ylmethyl)naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 110443097 |
| Molecular Formula | C14H12N2O2S2 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | N-(1,3-thiazol-2-ylmethyl)naphthalene-2-sulfonamide |
| SMILES | O=S(=O)(NCc1nccs1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C14H12N2O2S2/c17-20(18,16-10-14-15-7-8-19-14)13-6-5-11-3-1-2-4-12(11)9-13/h1-9,16H,10H2 |
| InChIKey | DXKDQDFJQLRAGF-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |