C17H21N3O3S2 — CID 72855243
N-cyclohexyl-3-(1,3-thiazol-2-ylmethylsulfamoyl)benzamide (PubChem CID 72855243) has the molecular formula C17H21N3O3S2 and a molecular weight of 379.51 g/mol. Its IUPAC name is N-cyclohexyl-3-(1,3-thiazol-2-ylmethylsulfamoyl)benzamide.
| Compound Name | N-cyclohexyl-3-(1,3-thiazol-2-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 72855243 |
| Molecular Formula | C17H21N3O3S2 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | N-cyclohexyl-3-(1,3-thiazol-2-ylmethylsulfamoyl)benzamide |
| SMILES | O=C(NC1CCCCC1)c1cccc(S(=O)(=O)NCc2nccs2)c1 |
| InChI | InChI=1S/C17H21N3O3S2/c21-17(20-14-6-2-1-3-7-14)13-5-4-8-15(11-13)25(22,23)19-12-16-18-9-10-24-16/h4-5,8-11,14,19H,1-3,6-7,12H2,(H,20,21) |
| InChIKey | VWMZYCFBWOBXBR-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |