C17H21N3O4S — CID 72867764
N-cyclopentyl-3-[(5-methyl-1,2-oxazol-3-yl)methylsulfamoyl]benzamide (PubChem CID 72867764) has the molecular formula C17H21N3O4S and a molecular weight of 363.44 g/mol. Its IUPAC name is N-cyclopentyl-3-[(5-methyl-1,2-oxazol-3-yl)methylsulfamoyl]benzamide.
| Compound Name | N-cyclopentyl-3-[(5-methyl-1,2-oxazol-3-yl)methylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 72867764 |
| Molecular Formula | C17H21N3O4S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | N-cyclopentyl-3-[(5-methyl-1,2-oxazol-3-yl)methylsulfamoyl]benzamide |
| SMILES | Cc1cc(CNS(=O)(=O)c2cccc(C(=O)NC3CCCC3)c2)no1 |
| InChI | InChI=1S/C17H21N3O4S/c1-12-9-15(20-24-12)11-18-25(22,23)16-8-4-5-13(10-16)17(21)19-14-6-2-3-7-14/h4-5,8-10,14,18H,2-3,6-7,11H2,1H3,(H,19,21) |
| InChIKey | CQZLZSNBMOLTLM-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |