C16H19N3O4S2 — CID 99941962
3-[[(3S)-oxolan-3-yl]methylsulfamoyl]-N-(1,3-thiazol-2-ylmethyl)benzamide (PubChem CID 99941962) has the molecular formula C16H19N3O4S2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 3-[[(3S)-oxolan-3-yl]methylsulfamoyl]-N-(1,3-thiazol-2-ylmethyl)benzamide.
| Compound Name | 3-[[(3S)-oxolan-3-yl]methylsulfamoyl]-N-(1,3-thiazol-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 99941962 |
| Molecular Formula | C16H19N3O4S2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 3-[[(3S)-oxolan-3-yl]methylsulfamoyl]-N-(1,3-thiazol-2-ylmethyl)benzamide |
| SMILES | O=C(NCc1nccs1)c1cccc(S(=O)(=O)NC[C@@H]2CCOC2)c1 |
| InChI | InChI=1S/C16H19N3O4S2/c20-16(18-10-15-17-5-7-24-15)13-2-1-3-14(8-13)25(21,22)19-9-12-4-6-23-11-12/h1-3,5,7-8,12,19H,4,6,9-11H2,(H,18,20)/t12-/m0/s1 |
| InChIKey | ZRRBSXLFDFCZQK-LBPRGKRZSA-N |
| XLogP | 1.39 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |