C16H22N2O4S2 — CID 74241225
N-(oxolan-3-ylmethyl)-3-thiomorpholin-4-ylsulfonylbenzamide (PubChem CID 74241225) has the molecular formula C16H22N2O4S2 and a molecular weight of 370.50 g/mol. Its IUPAC name is N-(oxolan-3-ylmethyl)-3-thiomorpholin-4-ylsulfonylbenzamide.
| Compound Name | N-(oxolan-3-ylmethyl)-3-thiomorpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 74241225 |
| Molecular Formula | C16H22N2O4S2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | N-(oxolan-3-ylmethyl)-3-thiomorpholin-4-ylsulfonylbenzamide |
| SMILES | O=C(NCC1CCOC1)c1cccc(S(=O)(=O)N2CCSCC2)c1 |
| InChI | InChI=1S/C16H22N2O4S2/c19-16(17-11-13-4-7-22-12-13)14-2-1-3-15(10-14)24(20,21)18-5-8-23-9-6-18/h1-3,10,13H,4-9,11-12H2,(H,17,19) |
| InChIKey | JDBHNXADKJRPBP-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |