C18H24N4O6S — CID 163340405
formic acid;N-(oxolan-3-ylmethyl)-3-(2-pyrazol-1-ylethylsulfamoyl)benzamide (PubChem CID 163340405) has the molecular formula C18H24N4O6S and a molecular weight of 424.48 g/mol. Its IUPAC name is formic acid;N-(oxolan-3-ylmethyl)-3-(2-pyrazol-1-ylethylsulfamoyl)benzamide.
| Compound Name | formic acid;N-(oxolan-3-ylmethyl)-3-(2-pyrazol-1-ylethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 163340405 |
| Molecular Formula | C18H24N4O6S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | formic acid;N-(oxolan-3-ylmethyl)-3-(2-pyrazol-1-ylethylsulfamoyl)benzamide |
| SMILES | O=C(NCC1CCOC1)c1cccc(S(=O)(=O)NCCn2cccn2)c1.O=CO |
| InChI | InChI=1S/C17H22N4O4S.CH2O2/c22-17(18-12-14-5-10-25-13-14)15-3-1-4-16(11-15)26(23,24)20-7-9-21-8-2-6-19-21;2-1-3/h1-4,6,8,11,14,20H,5,7,9-10,12-13H2,(H,18,22);1H,(H,2,3) |
| InChIKey | HNDAPYMOBFOHJQ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|