C17H22N4O4S — CID 97192159
3-[[(3S)-oxan-3-yl]sulfamoyl]-N-(2-pyrazol-1-ylethyl)benzamide (PubChem CID 97192159) has the molecular formula C17H22N4O4S and a molecular weight of 378.45 g/mol. Its IUPAC name is 3-[[(3S)-oxan-3-yl]sulfamoyl]-N-(2-pyrazol-1-ylethyl)benzamide.
| Compound Name | 3-[[(3S)-oxan-3-yl]sulfamoyl]-N-(2-pyrazol-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 97192159 |
| Molecular Formula | C17H22N4O4S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 3-[[(3S)-oxan-3-yl]sulfamoyl]-N-(2-pyrazol-1-ylethyl)benzamide |
| SMILES | O=C(NCCn1cccn1)c1cccc(S(=O)(=O)N[C@H]2CCCOC2)c1 |
| InChI | InChI=1S/C17H22N4O4S/c22-17(18-8-10-21-9-3-7-19-21)14-4-1-6-16(12-14)26(23,24)20-15-5-2-11-25-13-15/h1,3-4,6-7,9,12,15,20H,2,5,8,10-11,13H2,(H,18,22)/t15-/m0/s1 |
| InChIKey | JZLUPKRHOVUXAY-HNNXBMFYSA-N |
| XLogP | 0.77 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |