C13H15F3N2O4S — CID 99819133
3-[[(3R)-oxolan-3-yl]sulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 99819133) has the molecular formula C13H15F3N2O4S and a molecular weight of 352.33 g/mol. Its IUPAC name is 3-[[(3R)-oxolan-3-yl]sulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 3-[[(3R)-oxolan-3-yl]sulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 99819133 |
| Molecular Formula | C13H15F3N2O4S |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 3-[[(3R)-oxolan-3-yl]sulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=C(NCC(F)(F)F)c1cccc(S(=O)(=O)N[C@@H]2CCOC2)c1 |
| InChI | InChI=1S/C13H15F3N2O4S/c14-13(15,16)8-17-12(19)9-2-1-3-11(6-9)23(20,21)18-10-4-5-22-7-10/h1-3,6,10,18H,4-5,7-8H2,(H,17,19)/t10-/m1/s1 |
| InChIKey | RFHSXVXKHVBYNN-SNVBAGLBSA-N |
| XLogP | 1.05 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |