C11H13NO5S — CID 80717368
3-(oxolan-3-ylsulfamoyl)benzoic acid (PubChem CID 80717368) has the molecular formula C11H13NO5S and a molecular weight of 271.29 g/mol. Its IUPAC name is 3-(oxolan-3-ylsulfamoyl)benzoic acid.
| Compound Name | 3-(oxolan-3-ylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 80717368 |
| Molecular Formula | C11H13NO5S |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 3-(oxolan-3-ylsulfamoyl)benzoic acid |
| SMILES | O=C(O)c1cccc(S(=O)(=O)NC2CCOC2)c1 |
| InChI | InChI=1S/C11H13NO5S/c13-11(14)8-2-1-3-10(6-8)18(15,16)12-9-4-5-17-7-9/h1-3,6,9,12H,4-5,7H2,(H,13,14) |
| InChIKey | OOVRMGVZGUYBPH-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |