C11H14N2O4S — CID 80712621
N-(oxolan-3-yl)-3-sulfamoylbenzamide (PubChem CID 80712621) has the molecular formula C11H14N2O4S and a molecular weight of 270.31 g/mol. Its IUPAC name is N-(oxolan-3-yl)-3-sulfamoylbenzamide.
| Compound Name | N-(oxolan-3-yl)-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 80712621 |
| Molecular Formula | C11H14N2O4S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | N-(oxolan-3-yl)-3-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1cccc(C(=O)NC2CCOC2)c1 |
| InChI | InChI=1S/C11H14N2O4S/c12-18(15,16)10-3-1-2-8(6-10)11(14)13-9-4-5-17-7-9/h1-3,6,9H,4-5,7H2,(H,13,14)(H2,12,15,16) |
| InChIKey | ZJGSRWXLHUZVAI-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |