C15H22N2O3S — CID 64743154
N-(3,4-dimethylcyclohexyl)-3-sulfamoylbenzamide (PubChem CID 64743154) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is N-(3,4-dimethylcyclohexyl)-3-sulfamoylbenzamide.
| Compound Name | N-(3,4-dimethylcyclohexyl)-3-sulfamoylbenzamide |
|---|---|
| PubChem CID | 64743154 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | N-(3,4-dimethylcyclohexyl)-3-sulfamoylbenzamide |
| SMILES | CC1CCC(NC(=O)c2cccc(S(N)(=O)=O)c2)CC1C |
| InChI | InChI=1S/C15H22N2O3S/c1-10-6-7-13(8-11(10)2)17-15(18)12-4-3-5-14(9-12)21(16,19)20/h3-5,9-11,13H,6-8H2,1-2H3,(H,17,18)(H2,16,19,20) |
| InChIKey | IVGULMFHKWLIFO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |