C15H20INO — CID 64743317
N-(3,4-dimethylcyclohexyl)-3-iodobenzamide (PubChem CID 64743317) has the molecular formula C15H20INO and a molecular weight of 357.24 g/mol. Its IUPAC name is N-(3,4-dimethylcyclohexyl)-3-iodobenzamide.
| Compound Name | N-(3,4-dimethylcyclohexyl)-3-iodobenzamide |
|---|---|
| PubChem CID | 64743317 |
| Molecular Formula | C15H20INO |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | N-(3,4-dimethylcyclohexyl)-3-iodobenzamide |
| SMILES | CC1CCC(NC(=O)c2cccc(I)c2)CC1C |
| InChI | InChI=1S/C15H20INO/c1-10-6-7-14(8-11(10)2)17-15(18)12-4-3-5-13(16)9-12/h3-5,9-11,14H,6-8H2,1-2H3,(H,17,18) |
| InChIKey | RLSBZRKJMZNKBG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|