C13H18ClIN2O — CID 119474943
N-(4-aminocyclohexyl)-3-iodobenzamide;hydrochloride (PubChem CID 119474943) has the molecular formula C13H18ClIN2O and a molecular weight of 380.66 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-3-iodobenzamide;hydrochloride.
| Compound Name | N-(4-aminocyclohexyl)-3-iodobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119474943 |
| Molecular Formula | C13H18ClIN2O |
| Molecular Weight | 380.66 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | N-(4-aminocyclohexyl)-3-iodobenzamide;hydrochloride |
| SMILES | Cl.NC1CCC(NC(=O)c2cccc(I)c2)CC1 |
| InChI | InChI=1S/C13H17IN2O.ClH/c14-10-3-1-2-9(8-10)13(17)16-12-6-4-11(15)5-7-12;/h1-3,8,11-12H,4-7,15H2,(H,16,17);1H |
| InChIKey | OBUOGXWZFDFTMO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.66 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|