C14H21ClN2O3S — CID 119478074
N-(4-aminocyclohexyl)-3-methylsulfonylbenzamide;hydrochloride (PubChem CID 119478074) has the molecular formula C14H21ClN2O3S and a molecular weight of 332.85 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-3-methylsulfonylbenzamide;hydrochloride.
| Compound Name | N-(4-aminocyclohexyl)-3-methylsulfonylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119478074 |
| Molecular Formula | C14H21ClN2O3S |
| Molecular Weight | 332.85 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | N-(4-aminocyclohexyl)-3-methylsulfonylbenzamide;hydrochloride |
| SMILES | CS(=O)(=O)c1cccc(C(=O)NC2CCC(N)CC2)c1.Cl |
| InChI | InChI=1S/C14H20N2O3S.ClH/c1-20(18,19)13-4-2-3-10(9-13)14(17)16-12-7-5-11(15)6-8-12;/h2-4,9,11-12H,5-8,15H2,1H3,(H,16,17);1H |
| InChIKey | YOMLRLCAJSBFPX-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.85 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |