C13H19ClN2O3S — CID 119428145
3-methylsulfonyl-N-piperidin-3-ylbenzamide;hydrochloride (PubChem CID 119428145) has the molecular formula C13H19ClN2O3S and a molecular weight of 318.83 g/mol. Its IUPAC name is 3-methylsulfonyl-N-piperidin-3-ylbenzamide;hydrochloride.
| Compound Name | 3-methylsulfonyl-N-piperidin-3-ylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119428145 |
| Molecular Formula | C13H19ClN2O3S |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 3-methylsulfonyl-N-piperidin-3-ylbenzamide;hydrochloride |
| SMILES | CS(=O)(=O)c1cccc(C(=O)NC2CCCNC2)c1.Cl |
| InChI | InChI=1S/C13H18N2O3S.ClH/c1-19(17,18)12-6-2-4-10(8-12)13(16)15-11-5-3-7-14-9-11;/h2,4,6,8,11,14H,3,5,7,9H2,1H3,(H,15,16);1H |
| InChIKey | VFVSCLVGFVXNSQ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |