C15H22ClN3O3S — CID 119424241
N-piperidin-3-yl-3-(prop-2-enylsulfamoyl)benzamide;hydrochloride (PubChem CID 119424241) has the molecular formula C15H22ClN3O3S and a molecular weight of 359.88 g/mol. Its IUPAC name is N-piperidin-3-yl-3-(prop-2-enylsulfamoyl)benzamide;hydrochloride.
| Compound Name | N-piperidin-3-yl-3-(prop-2-enylsulfamoyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119424241 |
| Molecular Formula | C15H22ClN3O3S |
| Molecular Weight | 359.88 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | N-piperidin-3-yl-3-(prop-2-enylsulfamoyl)benzamide;hydrochloride |
| SMILES | C=CCNS(=O)(=O)c1cccc(C(=O)NC2CCCNC2)c1.Cl |
| InChI | InChI=1S/C15H21N3O3S.ClH/c1-2-8-17-22(20,21)14-7-3-5-12(10-14)15(19)18-13-6-4-9-16-11-13;/h2-3,5,7,10,13,16-17H,1,4,6,8-9,11H2,(H,18,19);1H |
| InChIKey | KMDYWTPNVMGZIN-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.88 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|