C17H25N3O3S — CID 119424342
3-(cyclopentylsulfamoyl)-N-piperidin-3-ylbenzamide (PubChem CID 119424342) has the molecular formula C17H25N3O3S and a molecular weight of 351.47 g/mol. Its IUPAC name is 3-(cyclopentylsulfamoyl)-N-piperidin-3-ylbenzamide.
| Compound Name | 3-(cyclopentylsulfamoyl)-N-piperidin-3-ylbenzamide |
|---|---|
| PubChem CID | 119424342 |
| Molecular Formula | C17H25N3O3S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 3-(cyclopentylsulfamoyl)-N-piperidin-3-ylbenzamide |
| SMILES | O=C(NC1CCCNC1)c1cccc(S(=O)(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C17H25N3O3S/c21-17(19-15-8-4-10-18-12-15)13-5-3-9-16(11-13)24(22,23)20-14-6-1-2-7-14/h3,5,9,11,14-15,18,20H,1-2,4,6-8,10,12H2,(H,19,21) |
| InChIKey | IIGQCONGJJZFOW-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |