C16H20N2O5S — CID 120676463
cis-(1S,3R)-3-[[3-(prop-2-enylsulfamoyl)benzoyl]amino]cyclopentane-1-carboxylic acid (PubChem CID 120676463) has the molecular formula C16H20N2O5S and a molecular weight of 352.41 g/mol. Its IUPAC name is cis-(1S,3R)-3-[[3-(prop-2-enylsulfamoyl)benzoyl]amino]cyclopentane-1-carboxylic acid.
| Compound Name | cis-(1S,3R)-3-[[3-(prop-2-enylsulfamoyl)benzoyl]amino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 120676463 |
| Molecular Formula | C16H20N2O5S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | cis-(1S,3R)-3-[[3-(prop-2-enylsulfamoyl)benzoyl]amino]cyclopentane-1-carboxylic acid |
| SMILES | C=CCNS(=O)(=O)c1cccc(C(=O)N[C@@H]2CC[C@H](C(=O)O)C2)c1 |
| InChI | InChI=1S/C16H20N2O5S/c1-2-8-17-24(22,23)14-5-3-4-11(10-14)15(19)18-13-7-6-12(9-13)16(20)21/h2-5,10,12-13,17H,1,6-9H2,(H,18,19)(H,20,21)/t12-,13+/m0/s1 |
| InChIKey | JHQCEJLQSMAHNG-QWHCGFSZSA-N |
| XLogP | 1.13 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|