C23H29N3O4S — CID 55951606
N-[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]-3-(prop-2-enylsulfamoyl)benzamide (PubChem CID 55951606) has the molecular formula C23H29N3O4S and a molecular weight of 443.57 g/mol. Its IUPAC name is N-[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]-3-(prop-2-enylsulfamoyl)benzamide.
| Compound Name | N-[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]-3-(prop-2-enylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55951606 |
| Molecular Formula | C23H29N3O4S |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | N-[1-[(2-methoxyphenyl)methyl]piperidin-4-yl]-3-(prop-2-enylsulfamoyl)benzamide |
| SMILES | C=CCNS(=O)(=O)c1cccc(C(=O)NC2CCN(Cc3ccccc3OC)CC2)c1 |
| InChI | InChI=1S/C23H29N3O4S/c1-3-13-24-31(28,29)21-9-6-8-18(16-21)23(27)25-20-11-14-26(15-12-20)17-19-7-4-5-10-22(19)30-2/h3-10,16,20,24H,1,11-15,17H2,2H3,(H,25,27) |
| InChIKey | ZKHDUQCNJNXMPQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|