C18H20N2O4S — CID 94633826
3-[(2-methoxyphenyl)methylsulfamoyl]-N-prop-2-enylbenzamide (PubChem CID 94633826) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is 3-[(2-methoxyphenyl)methylsulfamoyl]-N-prop-2-enylbenzamide.
| Compound Name | 3-[(2-methoxyphenyl)methylsulfamoyl]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 94633826 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 3-[(2-methoxyphenyl)methylsulfamoyl]-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1cccc(S(=O)(=O)NCc2ccccc2OC)c1 |
| InChI | InChI=1S/C18H20N2O4S/c1-3-11-19-18(21)14-8-6-9-16(12-14)25(22,23)20-13-15-7-4-5-10-17(15)24-2/h3-10,12,20H,1,11,13H2,2H3,(H,19,21) |
| InChIKey | YEFHTZXGQZDJQQ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|