C18H18N2O5S — CID 31529071
3-(1,3-benzodioxol-5-ylmethylsulfamoyl)-N-prop-2-enylbenzamide (PubChem CID 31529071) has the molecular formula C18H18N2O5S and a molecular weight of 374.42 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethylsulfamoyl)-N-prop-2-enylbenzamide.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethylsulfamoyl)-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 31529071 |
| Molecular Formula | C18H18N2O5S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethylsulfamoyl)-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1cccc(S(=O)(=O)NCc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C18H18N2O5S/c1-2-8-19-18(21)14-4-3-5-15(10-14)26(22,23)20-11-13-6-7-16-17(9-13)25-12-24-16/h2-7,9-10,20H,1,8,11-12H2,(H,19,21) |
| InChIKey | KXXQGMLBCWYTHC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|