C24H21ClN2O5S — CID 2496817
N-(1,3-benzodioxol-5-ylmethyl)-3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]benzamide (PubChem CID 2496817) has the molecular formula C24H21ClN2O5S and a molecular weight of 484.96 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]benzamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]benzamide |
|---|---|
| PubChem CID | 2496817 |
| Molecular Formula | C24H21ClN2O5S |
| Molecular Weight | 484.96 g/mol |
| Exact Mass | 484.09 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-3-[(2-chlorophenyl)-prop-2-enylsulfamoyl]benzamide |
| SMILES | C=CCN(c1ccccc1Cl)S(=O)(=O)c1cccc(C(=O)NCc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C24H21ClN2O5S/c1-2-12-27(21-9-4-3-8-20(21)25)33(29,30)19-7-5-6-18(14-19)24(28)26-15-17-10-11-22-23(13-17)32-16-31-22/h2-11,13-14H,1,12,15-16H2,(H,26,28) |
| InChIKey | ZTSUSCGPSCNZAU-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.96 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|